C15H10BrF2NOS — CID 104631391
2-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-1,3-benzothiazole (PubChem CID 104631391) has the molecular formula C15H10BrF2NOS and a molecular weight of 370.22 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-1,3-benzothiazole.
| Compound Name | 2-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 104631391 |
| Molecular Formula | C15H10BrF2NOS |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | 2-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-1,3-benzothiazole |
| SMILES | Fc1cc(CBr)cc(F)c1OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H10BrF2NOS/c16-7-9-5-10(17)15(11(18)6-9)20-8-14-19-12-3-1-2-4-13(12)21-14/h1-6H,7-8H2 |
| InChIKey | MUJSKKNILISBJB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|