C22H17NO2S — CID 7703664
1,3-benzothiazol-2-ylmethyl 2-(4-phenylphenyl)acetate (PubChem CID 7703664) has the molecular formula C22H17NO2S and a molecular weight of 359.45 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-(4-phenylphenyl)acetate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 7703664 |
| Molecular Formula | C22H17NO2S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-(4-phenylphenyl)acetate |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H17NO2S/c24-22(25-15-21-23-19-8-4-5-9-20(19)26-21)14-16-10-12-18(13-11-16)17-6-2-1-3-7-17/h1-13H,14-15H2 |
| InChIKey | VUOJZNUHTLNRSR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |