C21H21ClN2O5 — CID 7709558
2-(2-chlorophenoxy)ethyl 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7709558) has the molecular formula C21H21ClN2O5 and a molecular weight of 416.86 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | 2-(2-chlorophenoxy)ethyl 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7709558 |
| Molecular Formula | C21H21ClN2O5 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)OCCOc3ccccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C21H21ClN2O5/c1-14-7-9-15(10-8-14)21(2)19(26)24(20(27)23-21)13-18(25)29-12-11-28-17-6-4-3-5-16(17)22/h3-10H,11-13H2,1-2H3,(H,23,27)/t21-/m0/s1 |
| InChIKey | QYUGRDSUJPPGPA-NRFANRHFSA-N |
| XLogP | 3.04 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|