C13H13N3O2S — CID 104632098
1-(1,3-benzothiazol-2-ylmethyl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 104632098) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 104632098 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)NC(=O)N1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H13N3O2S/c1-13(2)11(17)15-12(18)16(13)7-10-14-8-5-3-4-6-9(8)19-10/h3-6H,7H2,1-2H3,(H,15,17,18) |
| InChIKey | FIKWZWXQKRBKGT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|