C16H11N3OS — CID 2362738
3-(1,3-benzothiazol-2-ylmethyl)quinazolin-4-one (PubChem CID 2362738) has the molecular formula C16H11N3OS and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylmethyl)quinazolin-4-one.
| Compound Name | 3-(1,3-benzothiazol-2-ylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2362738 |
| Molecular Formula | C16H11N3OS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylmethyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H11N3OS/c20-16-11-5-1-2-6-12(11)17-10-19(16)9-15-18-13-7-3-4-8-14(13)21-15/h1-8,10H,9H2 |
| InChIKey | GDJIXDZBTZPDTD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |