C12H11N5OS — CID 79765160
3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]quinazolin-4-one (PubChem CID 79765160) has the molecular formula C12H11N5OS and a molecular weight of 273.32 g/mol. Its IUPAC name is 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]quinazolin-4-one.
| Compound Name | 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 79765160 |
| Molecular Formula | C12H11N5OS |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]quinazolin-4-one |
| SMILES | NNc1ncc(Cn2cnc3ccccc3c2=O)s1 |
| InChI | InChI=1S/C12H11N5OS/c13-16-12-14-5-8(19-12)6-17-7-15-10-4-2-1-3-9(10)11(17)18/h1-5,7H,6,13H2,(H,14,16) |
| InChIKey | SHGBUOFYVVCCPW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|