C12H11N3O2S — CID 72926617
3-(1,3-benzothiazol-2-ylmethyl)-1,3-diazinane-2,4-dione (PubChem CID 72926617) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylmethyl)-1,3-diazinane-2,4-dione.
| Compound Name | 3-(1,3-benzothiazol-2-ylmethyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 72926617 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylmethyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCNC(=O)N1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H11N3O2S/c16-11-5-6-13-12(17)15(11)7-10-14-8-3-1-2-4-9(8)18-10/h1-4H,5-7H2,(H,13,17) |
| InChIKey | YJXRPYFNUZKHDU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |