C14H18N4O3 — CID 106528257
3-[[2-(methylamino)-3-pyridinyl]methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 106528257) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-[[2-(methylamino)-3-pyridinyl]methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[2-(methylamino)-3-pyridinyl]methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 106528257 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 3-[[2-(methylamino)-3-pyridinyl]methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CNc1ncccc1CN1C(=O)NC2(CCOCC2)C1=O |
| InChI | InChI=1S/C14H18N4O3/c1-15-11-10(3-2-6-16-11)9-18-12(19)14(17-13(18)20)4-7-21-8-5-14/h2-3,6H,4-5,7-9H2,1H3,(H,15,16)(H,17,20) |
| InChIKey | SRTXNNGBVPRRDQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|