C10H15N3O5 — CID 106528110
2-amino-3-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)propanoic acid (PubChem CID 106528110) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-amino-3-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)propanoic acid |
|---|---|
| PubChem CID | 106528110 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-amino-3-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)propanoic acid |
| SMILES | NC(CN1C(=O)NC2(CCOCC2)C1=O)C(=O)O |
| InChI | InChI=1S/C10H15N3O5/c11-6(7(14)15)5-13-8(16)10(12-9(13)17)1-3-18-4-2-10/h6H,1-5,11H2,(H,12,17)(H,14,15) |
| InChIKey | HNFMDEANKJNKKP-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|