C13H14N2O5 — CID 106528215
3-[2-(furan-2-yl)-2-oxoethyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 106528215) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)-2-oxoethyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-(furan-2-yl)-2-oxoethyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 106528215 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-[2-(furan-2-yl)-2-oxoethyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(CN1C(=O)NC2(CCOCC2)C1=O)c1ccco1 |
| InChI | InChI=1S/C13H14N2O5/c16-9(10-2-1-5-20-10)8-15-11(17)13(14-12(15)18)3-6-19-7-4-13/h1-2,5H,3-4,6-8H2,(H,14,18) |
| InChIKey | OAUITCXTOJSIRH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|