C10H16N4O5 — CID 106528282
hydrazinyl 3-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)propanoate (PubChem CID 106528282) has the molecular formula C10H16N4O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is hydrazinyl 3-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)propanoate.
| Compound Name | hydrazinyl 3-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)propanoate |
|---|---|
| PubChem CID | 106528282 |
| Molecular Formula | C10H16N4O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | hydrazinyl 3-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)propanoate |
| SMILES | NNOC(=O)CCN1C(=O)NC2(CCOCC2)C1=O |
| InChI | InChI=1S/C10H16N4O5/c11-13-19-7(15)1-4-14-8(16)10(12-9(14)17)2-5-18-6-3-10/h13H,1-6,11H2,(H,12,17) |
| InChIKey | OFSCFPANONVNBY-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|