C8H14N2O — CID 124537264
(5R)-2-methyl-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 124537264) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (5R)-2-methyl-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | (5R)-2-methyl-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 124537264 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (5R)-2-methyl-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | CN1CC[C@@]2(CCNC2)C1=O |
| InChI | InChI=1S/C8H14N2O/c1-10-5-3-8(7(10)11)2-4-9-6-8/h9H,2-6H2,1H3/t8-/m1/s1 |
| InChIKey | MNGHKFUPDAFHRO-MRVPVSSYSA-N |
| XLogP | -0.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |