C10H18N2O — CID 92775014
(5R)-2-ethyl-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 92775014) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (5R)-2-ethyl-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | (5R)-2-ethyl-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 92775014 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (5R)-2-ethyl-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | CCN1CC[C@@]2(CCCNC2)C1=O |
| InChI | InChI=1S/C10H18N2O/c1-2-12-7-5-10(9(12)13)4-3-6-11-8-10/h11H,2-8H2,1H3/t10-/m1/s1 |
| InChIKey | OWITXTLBTBXEDK-SNVBAGLBSA-N |
| XLogP | 0.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |