C15H20ClN3O3 — CID 45074137
2-[(4-nitrophenyl)methyl]-2,9-diazaspiro[4.5]decan-1-one;hydrochloride (PubChem CID 45074137) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methyl]-2,9-diazaspiro[4.5]decan-1-one;hydrochloride.
| Compound Name | 2-[(4-nitrophenyl)methyl]-2,9-diazaspiro[4.5]decan-1-one;hydrochloride |
|---|---|
| PubChem CID | 45074137 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[(4-nitrophenyl)methyl]-2,9-diazaspiro[4.5]decan-1-one;hydrochloride |
| SMILES | Cl.O=C1N(Cc2ccc([N+](=O)[O-])cc2)CCC12CCCNC2 |
| InChI | InChI=1S/C15H19N3O3.ClH/c19-14-15(6-1-8-16-11-15)7-9-17(14)10-12-2-4-13(5-3-12)18(20)21;/h2-5,16H,1,6-11H2;1H |
| InChIKey | YTHZOAADIFPEFB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|