C16H22ClN3O3 — CID 45074374
2-[(3-nitrophenyl)methyl]-2,8-diazaspiro[5.5]undecan-1-one;hydrochloride (PubChem CID 45074374) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is 2-[(3-nitrophenyl)methyl]-2,8-diazaspiro[5.5]undecan-1-one;hydrochloride.
| Compound Name | 2-[(3-nitrophenyl)methyl]-2,8-diazaspiro[5.5]undecan-1-one;hydrochloride |
|---|---|
| PubChem CID | 45074374 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-[(3-nitrophenyl)methyl]-2,8-diazaspiro[5.5]undecan-1-one;hydrochloride |
| SMILES | Cl.O=C1N(Cc2cccc([N+](=O)[O-])c2)CCCC12CCCNC2 |
| InChI | InChI=1S/C16H21N3O3.ClH/c20-15-16(6-2-8-17-12-16)7-3-9-18(15)11-13-4-1-5-14(10-13)19(21)22;/h1,4-5,10,17H,2-3,6-9,11-12H2;1H |
| InChIKey | SDYQRJVERGORGX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|