C16H22N2O — CID 95711606
(5S)-7-(2-phenylethyl)-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 95711606) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is (5S)-7-(2-phenylethyl)-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5S)-7-(2-phenylethyl)-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 95711606 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (5S)-7-(2-phenylethyl)-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | O=C1N(CCc2ccccc2)CCC[C@@]12CCNC2 |
| InChI | InChI=1S/C16H22N2O/c19-15-16(9-10-17-13-16)8-4-11-18(15)12-7-14-5-2-1-3-6-14/h1-3,5-6,17H,4,7-13H2/t16-/m0/s1 |
| InChIKey | GQXNHKWPZIGTMY-INIZCTEOSA-N |
| XLogP | 1.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |