C16H21BrN2O — CID 45074340
2-[(3-bromophenyl)methyl]-2,9-diazaspiro[5.5]undecan-1-one (PubChem CID 45074340) has the molecular formula C16H21BrN2O and a molecular weight of 337.26 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-2,9-diazaspiro[5.5]undecan-1-one.
| Compound Name | 2-[(3-bromophenyl)methyl]-2,9-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 45074340 |
| Molecular Formula | C16H21BrN2O |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-2,9-diazaspiro[5.5]undecan-1-one |
| SMILES | O=C1N(Cc2cccc(Br)c2)CCCC12CCNCC2 |
| InChI | InChI=1S/C16H21BrN2O/c17-14-4-1-3-13(11-14)12-19-10-2-5-16(15(19)20)6-8-18-9-7-16/h1,3-4,11,18H,2,5-10,12H2 |
| InChIKey | YXNDGEPWOHPDKU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |