C17H21N3O — CID 45074383
2-[(1-oxo-2,8-diazaspiro[5.5]undecan-2-yl)methyl]benzonitrile (PubChem CID 45074383) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-[(1-oxo-2,8-diazaspiro[5.5]undecan-2-yl)methyl]benzonitrile.
| Compound Name | 2-[(1-oxo-2,8-diazaspiro[5.5]undecan-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 45074383 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-[(1-oxo-2,8-diazaspiro[5.5]undecan-2-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1CCCC2(CCCNC2)C1=O |
| InChI | InChI=1S/C17H21N3O/c18-11-14-5-1-2-6-15(14)12-20-10-4-8-17(16(20)21)7-3-9-19-13-17/h1-2,5-6,19H,3-4,7-10,12-13H2 |
| InChIKey | GBVFFMAINKVOBH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |