C9H16N2OS — CID 171516524
2-methyl-7-methylsulfanyl-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 171516524) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 2-methyl-7-methylsulfanyl-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | 2-methyl-7-methylsulfanyl-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 171516524 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-methyl-7-methylsulfanyl-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | CSN1CCC2(CCN(C)C2=O)C1 |
| InChI | InChI=1S/C9H16N2OS/c1-10-5-3-9(8(10)12)4-6-11(7-9)13-2/h3-7H2,1-2H3 |
| InChIKey | OOLLGFBOCWANQF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|