C9H14N2O2 — CID 59929903
3,9-diazaspiro[5.5]undecane-2,5-dione (PubChem CID 59929903) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3,9-diazaspiro[5.5]undecane-2,5-dione.
| Compound Name | 3,9-diazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 59929903 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3,9-diazaspiro[5.5]undecane-2,5-dione |
| SMILES | O=C1CC2(CCNCC2)C(=O)CN1 |
| InChI | InChI=1S/C9H14N2O2/c12-7-6-11-8(13)5-9(7)1-3-10-4-2-9/h10H,1-6H2,(H,11,13) |
| InChIKey | KIHUZYPTQQZRJW-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |