C10H19N3O2 — CID 142838898
ethane;1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 142838898) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is ethane;1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | ethane;1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 142838898 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | ethane;1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CC.O=C1CNC(=O)C2(CCNCC2)N1 |
| InChI | InChI=1S/C8H13N3O2.C2H6/c12-6-5-10-7(13)8(11-6)1-3-9-4-2-8;1-2/h9H,1-5H2,(H,10,13)(H,11,12);1-2H3 |
| InChIKey | IIQPGLUCFCLONP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |