C10H17NO2 — CID 132549867
3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-7-one (PubChem CID 132549867) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-7-one.
| Compound Name | 3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 132549867 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-7-one |
| SMILES | CC1(C)COC2(CCNC(=O)C2)C1 |
| InChI | InChI=1S/C10H17NO2/c1-9(2)6-10(13-7-9)3-4-11-8(12)5-10/h3-7H2,1-2H3,(H,11,12) |
| InChIKey | HADWRWRSSKOUAY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |