C10H15NO2 — CID 178016231
3-azaspiro[5.5]undecane-4,9-dione (PubChem CID 178016231) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-azaspiro[5.5]undecane-4,9-dione.
| Compound Name | 3-azaspiro[5.5]undecane-4,9-dione |
|---|---|
| PubChem CID | 178016231 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-azaspiro[5.5]undecane-4,9-dione |
| SMILES | O=C1CCC2(CCNC(=O)C2)CC1 |
| InChI | InChI=1S/C10H15NO2/c12-8-1-3-10(4-2-8)5-6-11-9(13)7-10/h1-7H2,(H,11,13) |
| InChIKey | YCIBAOKOWRSKAO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |