C9H17ClN2O — CID 118385513
2,9-diazaspiro[4.6]undecan-3-one;hydrochloride (PubChem CID 118385513) has the molecular formula C9H17ClN2O and a molecular weight of 204.70 g/mol. Its IUPAC name is 2,9-diazaspiro[4.6]undecan-3-one;hydrochloride.
| Compound Name | 2,9-diazaspiro[4.6]undecan-3-one;hydrochloride |
|---|---|
| PubChem CID | 118385513 |
| Molecular Formula | C9H17ClN2O |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2,9-diazaspiro[4.6]undecan-3-one;hydrochloride |
| SMILES | Cl.O=C1CC2(CCCNCC2)CN1 |
| InChI | InChI=1S/C9H16N2O.ClH/c12-8-6-9(7-11-8)2-1-4-10-5-3-9;/h10H,1-7H2,(H,11,12);1H |
| InChIKey | LSZSTROGQHWHHP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |