C7H13NO3 — CID 150731285
4,4-dimethoxypiperidin-2-one (PubChem CID 150731285) has the molecular formula C7H13NO3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 4,4-dimethoxypiperidin-2-one.
| Compound Name | 4,4-dimethoxypiperidin-2-one |
|---|---|
| PubChem CID | 150731285 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 4,4-dimethoxypiperidin-2-one |
| SMILES | COC1(OC)CCNC(=O)C1 |
| InChI | InChI=1S/C7H13NO3/c1-10-7(11-2)3-4-8-6(9)5-7/h3-5H2,1-2H3,(H,8,9) |
| InChIKey | JRXAQBNYHHYDLU-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|