C8H13NO3 — CID 146591450
1,4-dioxa-9-azaspiro[4.6]undecan-10-one (PubChem CID 146591450) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 1,4-dioxa-9-azaspiro[4.6]undecan-10-one.
| Compound Name | 1,4-dioxa-9-azaspiro[4.6]undecan-10-one |
|---|---|
| PubChem CID | 146591450 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 1,4-dioxa-9-azaspiro[4.6]undecan-10-one |
| SMILES | O=C1CC2(CCCN1)OCCO2 |
| InChI | InChI=1S/C8H13NO3/c10-7-6-8(2-1-3-9-7)11-4-5-12-8/h1-6H2,(H,9,10) |
| InChIKey | XBLTXBOCVLOBHM-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |