C7H14N2O2S — CID 175977076
2λ6-thia-1,9-diazaspiro[4.5]decane 2,2-dioxide (PubChem CID 175977076) has the molecular formula C7H14N2O2S and a molecular weight of 190.27 g/mol. Its IUPAC name is 2λ6-thia-1,9-diazaspiro[4.5]decane 2,2-dioxide.
| Compound Name | 2λ6-thia-1,9-diazaspiro[4.5]decane 2,2-dioxide |
|---|---|
| PubChem CID | 175977076 |
| Molecular Formula | C7H14N2O2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 2λ6-thia-1,9-diazaspiro[4.5]decane 2,2-dioxide |
| SMILES | O=S1(=O)CCC2(CCCNC2)N1 |
| InChI | InChI=1S/C7H14N2O2S/c10-12(11)5-3-7(9-12)2-1-4-8-6-7/h8-9H,1-6H2 |
| InChIKey | MZSIIEAIZFTSQI-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |