C13H17F3N4O — CID 157153560
1,3-diazaspiro[4.5]decan-2-one;2-(trifluoromethyl)pyrimidine (PubChem CID 157153560) has the molecular formula C13H17F3N4O and a molecular weight of 302.30 g/mol. Its IUPAC name is 1,3-diazaspiro[4.5]decan-2-one;2-(trifluoromethyl)pyrimidine.
| Compound Name | 1,3-diazaspiro[4.5]decan-2-one;2-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 157153560 |
| Molecular Formula | C13H17F3N4O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1,3-diazaspiro[4.5]decan-2-one;2-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1ncccn1.O=C1NCC2(CCCCC2)N1 |
| InChI | InChI=1S/C8H14N2O.C5H3F3N2/c11-7-9-6-8(10-7)4-2-1-3-5-8;6-5(7,8)4-9-2-1-3-10-4/h1-6H2,(H2,9,10,11);1-3H |
| InChIKey | ALNSXODHVMOBCG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |