C14H16F3N3O — CID 150305620
1-[6-(trifluoromethyl)-3-pyridinyl]-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 150305620) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 1-[6-(trifluoromethyl)-3-pyridinyl]-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 1-[6-(trifluoromethyl)-3-pyridinyl]-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 150305620 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-[6-(trifluoromethyl)-3-pyridinyl]-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1NCC2(CCCCC2)N1c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H16F3N3O/c15-14(16,17)11-5-4-10(8-18-11)20-12(21)19-9-13(20)6-2-1-3-7-13/h4-5,8H,1-3,6-7,9H2,(H,19,21) |
| InChIKey | GKNIFLBSHPBQCW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |