C10H6F3N3O3 — CID 112598156
1-[6-(trifluoromethyl)-3-pyridinyl]-1,3-diazinane-2,4,6-trione (PubChem CID 112598156) has the molecular formula C10H6F3N3O3 and a molecular weight of 273.17 g/mol. Its IUPAC name is 1-[6-(trifluoromethyl)-3-pyridinyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[6-(trifluoromethyl)-3-pyridinyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112598156 |
| Molecular Formula | C10H6F3N3O3 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 1-[6-(trifluoromethyl)-3-pyridinyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)N(c2ccc(C(F)(F)F)nc2)C(=O)N1 |
| InChI | InChI=1S/C10H6F3N3O3/c11-10(12,13)6-2-1-5(4-14-6)16-8(18)3-7(17)15-9(16)19/h1-2,4H,3H2,(H,15,17,19) |
| InChIKey | BVGHILNTGDGPAU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|