C10H10F3N3O — CID 82817749
1-[6-(trifluoromethyl)-3-pyridinyl]-1,3-diazinan-2-one (PubChem CID 82817749) has the molecular formula C10H10F3N3O and a molecular weight of 245.20 g/mol. Its IUPAC name is 1-[6-(trifluoromethyl)-3-pyridinyl]-1,3-diazinan-2-one.
| Compound Name | 1-[6-(trifluoromethyl)-3-pyridinyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 82817749 |
| Molecular Formula | C10H10F3N3O |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-[6-(trifluoromethyl)-3-pyridinyl]-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C10H10F3N3O/c11-10(12,13)8-3-2-7(6-15-8)16-5-1-4-14-9(16)17/h2-3,6H,1,4-5H2,(H,14,17) |
| InChIKey | AMGUMZKSRXKBJE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |