C9H7N3O3 — CID 112597689
1-pyridin-3-yl-1,3-diazinane-2,4,6-trione (PubChem CID 112597689) has the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. Its IUPAC name is 1-pyridin-3-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-pyridin-3-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112597689 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 1-pyridin-3-yl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)N(c2cccnc2)C(=O)N1 |
| InChI | InChI=1S/C9H7N3O3/c13-7-4-8(14)12(9(15)11-7)6-2-1-3-10-5-6/h1-3,5H,4H2,(H,11,13,15) |
| InChIKey | BYIMNGJNRFVCTR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|