C13H18O4 — CID 170152284
5,5,11,11-tetramethyl-3,9-dioxatricyclo[6.3.0.02,6]undecane-4,10-dione (PubChem CID 170152284) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 5,5,11,11-tetramethyl-3,9-dioxatricyclo[6.3.0.02,6]undecane-4,10-dione.
| Compound Name | 5,5,11,11-tetramethyl-3,9-dioxatricyclo[6.3.0.02,6]undecane-4,10-dione |
|---|---|
| PubChem CID | 170152284 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 5,5,11,11-tetramethyl-3,9-dioxatricyclo[6.3.0.02,6]undecane-4,10-dione |
| SMILES | CC1(C)C(=O)OC2C1CC1OC(=O)C(C)(C)C12 |
| InChI | InChI=1S/C13H18O4/c1-12(2)6-5-7-8(9(6)17-10(12)14)13(3,4)11(15)16-7/h6-9H,5H2,1-4H3 |
| InChIKey | SPMSEASFKXQHDZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |