C11H16O4 — CID 54567245
(1R,2R,6R,8R)-4,4,8-trimethyl-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-one (PubChem CID 54567245) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (1R,2R,6R,8R)-4,4,8-trimethyl-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-one.
| Compound Name | (1R,2R,6R,8R)-4,4,8-trimethyl-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-one |
|---|---|
| PubChem CID | 54567245 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (1R,2R,6R,8R)-4,4,8-trimethyl-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-one |
| SMILES | CC1(C)O[C@H]2[C@H]3C[C@@](C)(C[C@H]2O1)C(=O)O3 |
| InChI | InChI=1S/C11H16O4/c1-10(2)14-7-5-11(3)4-6(8(7)15-10)13-9(11)12/h6-8H,4-5H2,1-3H3/t6-,7-,8+,11+/m1/s1 |
| InChIKey | ZUSBKIUVHNDFMP-LEQIOUOKSA-N |
| XLogP | 1.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |