C9H12O2S — CID 146254697
6-methyl-9-sulfanyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 146254697) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is 6-methyl-9-sulfanyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
| Compound Name | 6-methyl-9-sulfanyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
|---|---|
| PubChem CID | 146254697 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 6-methyl-9-sulfanyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | CC12C(=O)OC3CC(CC31)C2S |
| InChI | InChI=1S/C9H12O2S/c1-9-5-2-4(7(9)12)3-6(5)11-8(9)10/h4-7,12H,2-3H2,1H3 |
| InChIKey | DJOYKPVDSZVCIQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|