C15H18O3 — CID 134961874
(1R,12R,14S)-6,10-dimethyl-3,11-dioxapentacyclo[8.4.1.01,7.04,14.07,12]pentadec-8-en-2-one (PubChem CID 134961874) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1R,12R,14S)-6,10-dimethyl-3,11-dioxapentacyclo[8.4.1.01,7.04,14.07,12]pentadec-8-en-2-one.
| Compound Name | (1R,12R,14S)-6,10-dimethyl-3,11-dioxapentacyclo[8.4.1.01,7.04,14.07,12]pentadec-8-en-2-one |
|---|---|
| PubChem CID | 134961874 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (1R,12R,14S)-6,10-dimethyl-3,11-dioxapentacyclo[8.4.1.01,7.04,14.07,12]pentadec-8-en-2-one |
| SMILES | CC1CC2OC(=O)[C@@]34CC5(C)C=CC13[C@@H](C[C@H]24)O5 |
| InChI | InChI=1S/C15H18O3/c1-8-5-10-9-6-11-14(8)4-3-13(2,18-11)7-15(9,14)12(16)17-10/h3-4,8-11H,5-7H2,1-2H3/t8?,9-,10?,11-,13?,14?,15+/m1/s1 |
| InChIKey | SEZFTSPXDZZOIE-CCXFKZIOSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|