C18H18O4 — CID 164680435
(1R,10R,11R,12S,15S)-10-hydroxy-7,15-dimethyl-13-oxapentacyclo[10.2.2.18,11.01,10.04,9]heptadeca-4(9),5,7-triene-3,14-dione (PubChem CID 164680435) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is (1R,10R,11R,12S,15S)-10-hydroxy-7,15-dimethyl-13-oxapentacyclo[10.2.2.18,11.01,10.04,9]heptadeca-4(9),5,7-triene-3,14-dione.
| Compound Name | (1R,10R,11R,12S,15S)-10-hydroxy-7,15-dimethyl-13-oxapentacyclo[10.2.2.18,11.01,10.04,9]heptadeca-4(9),5,7-triene-3,14-dione |
|---|---|
| PubChem CID | 164680435 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (1R,10R,11R,12S,15S)-10-hydroxy-7,15-dimethyl-13-oxapentacyclo[10.2.2.18,11.01,10.04,9]heptadeca-4(9),5,7-triene-3,14-dione |
| SMILES | Cc1ccc2c3c1C[C@@H]1[C@@H]4C[C@H](C)[C@@](CC2=O)(C(=O)O4)[C@]31O |
| InChI | InChI=1S/C18H18O4/c1-8-3-4-10-13(19)7-17-9(2)5-14(22-16(17)20)12-6-11(8)15(10)18(12,17)21/h3-4,9,12,14,21H,5-7H2,1-2H3/t9-,12+,14-,17-,18+/m0/s1 |
| InChIKey | XYVHBVVLSRNIAJ-RBIOVCBTSA-N |
| XLogP | 1.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |