C21H26O3Si — CID 162417279
(11R)-7-methyl-15-methylidene-10-trimethylsilyloxy-13-oxapentacyclo[10.2.2.18,11.01,10.04,9]heptadeca-4(9),5,7-trien-14-one (PubChem CID 162417279) has the molecular formula C21H26O3Si and a molecular weight of 354.52 g/mol. Its IUPAC name is (11R)-7-methyl-15-methylidene-10-trimethylsilyloxy-13-oxapentacyclo[10.2.2.18,11.01,10.04,9]heptadeca-4(9),5,7-trien-14-one.
| Compound Name | (11R)-7-methyl-15-methylidene-10-trimethylsilyloxy-13-oxapentacyclo[10.2.2.18,11.01,10.04,9]heptadeca-4(9),5,7-trien-14-one |
|---|---|
| PubChem CID | 162417279 |
| Molecular Formula | C21H26O3Si |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (11R)-7-methyl-15-methylidene-10-trimethylsilyloxy-13-oxapentacyclo[10.2.2.18,11.01,10.04,9]heptadeca-4(9),5,7-trien-14-one |
| SMILES | C=C1CC2OC(=O)C13CCc1ccc(C)c4c1C3(O[Si](C)(C)C)[C@@H]2C4 |
| InChI | InChI=1S/C21H26O3Si/c1-12-6-7-14-8-9-20-13(2)10-17(23-19(20)22)16-11-15(12)18(14)21(16,20)24-25(3,4)5/h6-7,16-17H,2,8-11H2,1,3-5H3/t16-,17?,20?,21?/m1/s1 |
| InChIKey | ZTDSHIBDBPSVFH-GHNZTPCLSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|