About 3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene
3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene (PubChem CID 177102559) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is 3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene.
Analyze 3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene?
The IUPAC name of 3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene (CID 177102559) is 3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene.
What is the SMILES notation for 3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene?
The canonical SMILES for 3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene is Cc1ccc2c3c1CCCC3(C)CC2.
What is the InChIKey of 3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene?
The InChIKey is BZNRSEFPJMFCBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18/c1-10-5-6-11-7-9-14(2)8-3-4-12(10)13(11)14/h5-6H,3-4,7-9H2,1-2H3.
What are the key properties of 3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene?
3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene has a molecular weight of 186.30 g/mol, XLogP of 3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,6-dimethyl-2,3,4,5-tetrahydro-1H-acenaphthylene is sourced from PubChem (CID 177102559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).