C18H24 — CID 56994043
2,4-dimethyl-7-(1-methylcyclohexyl)-1H-indene (PubChem CID 56994043) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2,4-dimethyl-7-(1-methylcyclohexyl)-1H-indene.
| Compound Name | 2,4-dimethyl-7-(1-methylcyclohexyl)-1H-indene |
|---|---|
| PubChem CID | 56994043 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 2,4-dimethyl-7-(1-methylcyclohexyl)-1H-indene |
| SMILES | CC1=Cc2c(C)ccc(C3(C)CCCCC3)c2C1 |
| InChI | InChI=1S/C18H24/c1-13-11-15-14(2)7-8-17(16(15)12-13)18(3)9-5-4-6-10-18/h7-8,11H,4-6,9-10,12H2,1-3H3 |
| InChIKey | DEJFCENASSUHSC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |