C25H32 — CID 123862995
7-(3,5-ditert-butylphenyl)-2,4-dimethyl-1H-indene (PubChem CID 123862995) has the molecular formula C25H32 and a molecular weight of 332.53 g/mol. Its IUPAC name is 7-(3,5-ditert-butylphenyl)-2,4-dimethyl-1H-indene.
| Compound Name | 7-(3,5-ditert-butylphenyl)-2,4-dimethyl-1H-indene |
|---|---|
| PubChem CID | 123862995 |
| Molecular Formula | C25H32 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 7-(3,5-ditert-butylphenyl)-2,4-dimethyl-1H-indene |
| SMILES | CC1=Cc2c(C)ccc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2C1 |
| InChI | InChI=1S/C25H32/c1-16-11-22-17(2)9-10-21(23(22)12-16)18-13-19(24(3,4)5)15-20(14-18)25(6,7)8/h9-11,13-15H,12H2,1-8H3 |
| InChIKey | ABPNCBWOPNYQAS-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |