C30H34 — CID 59537041
4,7-bis(4-tert-butylphenyl)-2-methyl-1H-indene (PubChem CID 59537041) has the molecular formula C30H34 and a molecular weight of 394.60 g/mol. Its IUPAC name is 4,7-bis(4-tert-butylphenyl)-2-methyl-1H-indene.
| Compound Name | 4,7-bis(4-tert-butylphenyl)-2-methyl-1H-indene |
|---|---|
| PubChem CID | 59537041 |
| Molecular Formula | C30H34 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 4,7-bis(4-tert-butylphenyl)-2-methyl-1H-indene |
| SMILES | CC1=Cc2c(-c3ccc(C(C)(C)C)cc3)ccc(-c3ccc(C(C)(C)C)cc3)c2C1 |
| InChI | InChI=1S/C30H34/c1-20-18-27-25(21-8-12-23(13-9-21)29(2,3)4)16-17-26(28(27)19-20)22-10-14-24(15-11-22)30(5,6)7/h8-18H,19H2,1-7H3 |
| InChIKey | AGIHSAABFKDLJO-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |