C24H30O — CID 123867978
7-(3-tert-butyl-5-propan-2-ylphenyl)-4-methoxy-2-methyl-1H-indene (PubChem CID 123867978) has the molecular formula C24H30O and a molecular weight of 334.50 g/mol. Its IUPAC name is 7-(3-tert-butyl-5-propan-2-ylphenyl)-4-methoxy-2-methyl-1H-indene.
| Compound Name | 7-(3-tert-butyl-5-propan-2-ylphenyl)-4-methoxy-2-methyl-1H-indene |
|---|---|
| PubChem CID | 123867978 |
| Molecular Formula | C24H30O |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 7-(3-tert-butyl-5-propan-2-ylphenyl)-4-methoxy-2-methyl-1H-indene |
| SMILES | COc1ccc(-c2cc(C(C)C)cc(C(C)(C)C)c2)c2c1C=C(C)C2 |
| InChI | InChI=1S/C24H30O/c1-15(2)17-12-18(14-19(13-17)24(4,5)6)20-8-9-23(25-7)22-11-16(3)10-21(20)22/h8-9,11-15H,10H2,1-7H3 |
| InChIKey | RWOWPZJAYBVIDH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |