C34H42 — CID 173016294
4,7-bis(4-tert-butylphenyl)-2-(2,2-dimethylpropyl)-1H-indene (PubChem CID 173016294) has the molecular formula C34H42 and a molecular weight of 450.71 g/mol. Its IUPAC name is 4,7-bis(4-tert-butylphenyl)-2-(2,2-dimethylpropyl)-1H-indene.
| Compound Name | 4,7-bis(4-tert-butylphenyl)-2-(2,2-dimethylpropyl)-1H-indene |
|---|---|
| PubChem CID | 173016294 |
| Molecular Formula | C34H42 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | 4,7-bis(4-tert-butylphenyl)-2-(2,2-dimethylpropyl)-1H-indene |
| SMILES | CC(C)(C)CC1=Cc2c(-c3ccc(C(C)(C)C)cc3)ccc(-c3ccc(C(C)(C)C)cc3)c2C1 |
| InChI | InChI=1S/C34H42/c1-32(2,3)22-23-20-30-28(24-10-14-26(15-11-24)33(4,5)6)18-19-29(31(30)21-23)25-12-16-27(17-13-25)34(7,8)9/h10-20H,21-22H2,1-9H3 |
| InChIKey | BETZVYPQQOQUPY-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |