C11H11I — CID 145268239
2-iodo-4,7-dimethyl-1H-indene (PubChem CID 145268239) has the molecular formula C11H11I and a molecular weight of 270.11 g/mol. Its IUPAC name is 2-iodo-4,7-dimethyl-1H-indene.
| Compound Name | 2-iodo-4,7-dimethyl-1H-indene |
|---|---|
| PubChem CID | 145268239 |
| Molecular Formula | C11H11I |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 2-iodo-4,7-dimethyl-1H-indene |
| SMILES | Cc1ccc(C)c2c1C=C(I)C2 |
| InChI | InChI=1S/C11H11I/c1-7-3-4-8(2)11-6-9(12)5-10(7)11/h3-5H,6H2,1-2H3 |
| InChIKey | PHNAZGFFXSHGFK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|