C17H25P — CID 21096605
(4,7-dimethyl-1H-inden-2-yl)-dipropylphosphane (PubChem CID 21096605) has the molecular formula C17H25P and a molecular weight of 260.36 g/mol. Its IUPAC name is (4,7-dimethyl-1H-inden-2-yl)-dipropylphosphane.
| Compound Name | (4,7-dimethyl-1H-inden-2-yl)-dipropylphosphane |
|---|---|
| PubChem CID | 21096605 |
| Molecular Formula | C17H25P |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | (4,7-dimethyl-1H-inden-2-yl)-dipropylphosphane |
| SMILES | CCCP(CCC)C1=Cc2c(C)ccc(C)c2C1 |
| InChI | InChI=1S/C17H25P/c1-5-9-18(10-6-2)15-11-16-13(3)7-8-14(4)17(16)12-15/h7-8,11H,5-6,9-10,12H2,1-4H3 |
| InChIKey | AHJSMICUDPIJOA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|