C17H24Si — CID 177102366
1,4,9-trimethyl-4-silatetracyclo[6.5.2.04,15.011,14]pentadeca-8(15),9,11(14)-triene (PubChem CID 177102366) has the molecular formula C17H24Si and a molecular weight of 256.46 g/mol. Its IUPAC name is 1,4,9-trimethyl-4-silatetracyclo[6.5.2.04,15.011,14]pentadeca-8(15),9,11(14)-triene.
| Compound Name | 1,4,9-trimethyl-4-silatetracyclo[6.5.2.04,15.011,14]pentadeca-8(15),9,11(14)-triene |
|---|---|
| PubChem CID | 177102366 |
| Molecular Formula | C17H24Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1,4,9-trimethyl-4-silatetracyclo[6.5.2.04,15.011,14]pentadeca-8(15),9,11(14)-triene |
| SMILES | Cc1cc2c3c4c1CCC[Si]4(C)CCC3(C)CC2 |
| InChI | InChI=1S/C17H24Si/c1-12-11-13-6-7-17(2)8-10-18(3)9-4-5-14(12)16(18)15(13)17/h11H,4-10H2,1-3H3 |
| InChIKey | CLTPESLDYKTGIT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|