C19H20O4 — CID 162982080
(1R,11S,12R,13S,16R)-11-hydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione (PubChem CID 162982080) has the molecular formula C19H20O4 and a molecular weight of 312.36 g/mol. Its IUPAC name is (1R,11S,12R,13S,16R)-11-hydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione.
| Compound Name | (1R,11S,12R,13S,16R)-11-hydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione |
|---|---|
| PubChem CID | 162982080 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (1R,11S,12R,13S,16R)-11-hydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione |
| SMILES | Cc1cc(=O)cc2c3c1C[C@@H]1[C@@H]4C[C@@H](C)[C@@](CC2)(C(=O)O4)[C@@]31O |
| InChI | InChI=1S/C19H20O4/c1-9-5-12(20)7-11-3-4-18-10(2)6-15(23-17(18)21)14-8-13(9)16(11)19(14,18)22/h5,7,10,14-15,22H,3-4,6,8H2,1-2H3/t10-,14-,15+,18+,19+/m1/s1 |
| InChIKey | UYWLIDSGDVLTEF-MYKPGHPJSA-N |
| XLogP | 1.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |