C18H18O4 — CID 164680730
(1R,10R,11R,15R)-10-hydroxy-7,18-dimethyl-13,16-dioxahexacyclo[12.3.1.01,10.04,9.08,12.011,15]octadeca-4(9),5,7-trien-17-one (PubChem CID 164680730) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is (1R,10R,11R,15R)-10-hydroxy-7,18-dimethyl-13,16-dioxahexacyclo[12.3.1.01,10.04,9.08,12.011,15]octadeca-4(9),5,7-trien-17-one.
| Compound Name | (1R,10R,11R,15R)-10-hydroxy-7,18-dimethyl-13,16-dioxahexacyclo[12.3.1.01,10.04,9.08,12.011,15]octadeca-4(9),5,7-trien-17-one |
|---|---|
| PubChem CID | 164680730 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (1R,10R,11R,15R)-10-hydroxy-7,18-dimethyl-13,16-dioxahexacyclo[12.3.1.01,10.04,9.08,12.011,15]octadeca-4(9),5,7-trien-17-one |
| SMILES | Cc1ccc2c3c1C1OC4C(C)[C@@]5(CC2)C(=O)O[C@@H]4[C@@H]1[C@@]35O |
| InChI | InChI=1S/C18H18O4/c1-7-3-4-9-5-6-17-8(2)13-15(22-16(17)19)12-14(21-13)10(7)11(9)18(12,17)20/h3-4,8,12-15,20H,5-6H2,1-2H3/t8?,12-,13?,14?,15-,17+,18+/m1/s1 |
| InChIKey | FDCXGNYTVAIQEA-FWOYMERRSA-N |
| XLogP | 1.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |