C20H34O3Si2 — CID 101256549
(1-methoxy-9b-trimethylsilyloxy-3,3a,4,5-tetrahydro-2H-cyclopenta[a]naphthalen-1-yl)oxy-trimethylsilane (PubChem CID 101256549) has the molecular formula C20H34O3Si2 and a molecular weight of 378.66 g/mol. Its IUPAC name is (1-methoxy-9b-trimethylsilyloxy-3,3a,4,5-tetrahydro-2H-cyclopenta[a]naphthalen-1-yl)oxy-trimethylsilane.
| Compound Name | (1-methoxy-9b-trimethylsilyloxy-3,3a,4,5-tetrahydro-2H-cyclopenta[a]naphthalen-1-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 101256549 |
| Molecular Formula | C20H34O3Si2 |
| Molecular Weight | 378.66 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (1-methoxy-9b-trimethylsilyloxy-3,3a,4,5-tetrahydro-2H-cyclopenta[a]naphthalen-1-yl)oxy-trimethylsilane |
| SMILES | COC1(O[Si](C)(C)C)CCC2CCc3ccccc3C21O[Si](C)(C)C |
| InChI | InChI=1S/C20H34O3Si2/c1-21-19(22-24(2,3)4)15-14-17-13-12-16-10-8-9-11-18(16)20(17,19)23-25(5,6)7/h8-11,17H,12-15H2,1-7H3 |
| InChIKey | LFBOUXJGYLRZMU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|